C21H27N5O2 — CID 142447186
benzyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)pyrazin-2-yl]acetate;ethane (PubChem CID 142447186) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is benzyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)pyrazin-2-yl]acetate;ethane.
| Compound Name | benzyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)pyrazin-2-yl]acetate;ethane |
|---|---|
| PubChem CID | 142447186 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | benzyl 2-cyano-2-[3-(4-methylpiperazin-1-yl)pyrazin-2-yl]acetate;ethane |
| SMILES | CC.CN1CCN(c2nccnc2C(C#N)C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N5O2.C2H6/c1-23-9-11-24(12-10-23)18-17(21-7-8-22-18)16(13-20)19(25)26-14-15-5-3-2-4-6-15;1-2/h2-8,16H,9-12,14H2,1H3;1-2H3 |
| InChIKey | DJKNWAFTLPSPEZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |