C23H28N2O4 — CID 174252125
3-(4-acetylphenyl)-2-[[4-[2-(methylamino)-3-oxobutyl]phenyl]methylamino]propanoic acid (PubChem CID 174252125) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-2-[[4-[2-(methylamino)-3-oxobutyl]phenyl]methylamino]propanoic acid.
| Compound Name | 3-(4-acetylphenyl)-2-[[4-[2-(methylamino)-3-oxobutyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 174252125 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-(4-acetylphenyl)-2-[[4-[2-(methylamino)-3-oxobutyl]phenyl]methylamino]propanoic acid |
| SMILES | CNC(Cc1ccc(CNC(Cc2ccc(C(C)=O)cc2)C(=O)O)cc1)C(C)=O |
| InChI | InChI=1S/C23H28N2O4/c1-15(26)20-10-8-18(9-11-20)13-22(23(28)29)25-14-19-6-4-17(5-7-19)12-21(24-3)16(2)27/h4-11,21-22,24-25H,12-14H2,1-3H3,(H,28,29) |
| InChIKey | SZPUZGCHYAMAME-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |