C48H37N3 — CID 174254357
(4Z,6Z)-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3-methylidene-8,13-diphenyl-N-(4-phenylphenyl)-8,13-diazatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14(19),15,17-octaen-16-amine (PubChem CID 174254357) has the molecular formula C48H37N3 and a molecular weight of 655.85 g/mol. Its IUPAC name is (4Z,6Z)-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3-methylidene-8,13-diphenyl-N-(4-phenylphenyl)-8,13-diazatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14(19),15,17-octaen-16-amine.
| Compound Name | (4Z,6Z)-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3-methylidene-8,13-diphenyl-N-(4-phenylphenyl)-8,13-diazatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14(19),15,17-octaen-16-amine |
|---|---|
| PubChem CID | 174254357 |
| Molecular Formula | C48H37N3 |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | (4Z,6Z)-N-[(1Z,3Z)-hexa-1,3,5-trienyl]-3-methylidene-8,13-diphenyl-N-(4-phenylphenyl)-8,13-diazatetracyclo[10.7.0.02,9.014,19]nonadeca-1(12),2(9),4,6,10,14(19),15,17-octaen-16-amine |
| SMILES | C=C/C=C\C=C/N(c1ccc(-c2ccccc2)cc1)c1ccc2c3c4c(ccc3n(-c3ccccc3)c2c1)N(c1ccccc1)/C=C\C=C/C4=C |
| InChI | InChI=1S/C48H37N3/c1-3-4-5-16-33-49(40-27-25-38(26-28-40)37-19-9-6-10-20-37)42-29-30-43-46(35-42)51(41-23-13-8-14-24-41)45-32-31-44-47(48(43)45)36(2)18-15-17-34-50(44)39-21-11-7-12-22-39/h3-35H,1-2H2/b5-4-,18-15-,33-16-,34-17- |
| InChIKey | VPEOTCZLOZUURO-TZMWFJMVSA-N |
| XLogP | 13.08 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|