About 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine
1-ethyl-N-ethynyl-N-methylpiperidin-4-amine (PubChem CID 174254399) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine.
Molecular Properties
| Compound Name | 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine |
| PubChem CID | 174254399 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine |
| SMILES | C#CN(C)C1CCN(CC)CC1 |
| InChI | InChI=1S/C10H18N2/c1-4-11(3)10-6-8-12(5-2)9-7-10/h1,10H,5-9H2,2-3H3 |
| InChIKey | PMYGMZLTTSEZNQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine?
The IUPAC name of 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine (CID 174254399) is 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine.
What is the SMILES notation for 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine?
The canonical SMILES for 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine is C#CN(C)C1CCN(CC)CC1.
What is the InChIKey of 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine?
The InChIKey is PMYGMZLTTSEZNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-11(3)10-6-8-12(5-2)9-7-10/h1,10H,5-9H2,2-3H3.
What are the key properties of 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine?
1-ethyl-N-ethynyl-N-methylpiperidin-4-amine has a molecular weight of 166.27 g/mol, XLogP of 0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-ethynyl-N-methylpiperidin-4-amine is sourced from PubChem (CID 174254399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).