C16H35NO — CID 174260797
(2S,4S)-2,4-dimethyl-6-(octylamino)hexan-1-ol (PubChem CID 174260797) has the molecular formula C16H35NO and a molecular weight of 257.46 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethyl-6-(octylamino)hexan-1-ol.
| Compound Name | (2S,4S)-2,4-dimethyl-6-(octylamino)hexan-1-ol |
|---|---|
| PubChem CID | 174260797 |
| Molecular Formula | C16H35NO |
| Molecular Weight | 257.46 g/mol |
| Exact Mass | 257.27 |
| IUPAC Name | (2S,4S)-2,4-dimethyl-6-(octylamino)hexan-1-ol |
| SMILES | CCCCCCCCNCC[C@@H](C)C[C@H](C)CO |
| InChI | InChI=1S/C16H35NO/c1-4-5-6-7-8-9-11-17-12-10-15(2)13-16(3)14-18/h15-18H,4-14H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | XTIYZCUYVWGLTL-CVEARBPZSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|