C15H13F2N3O4 — CID 174262503
N-[4-(difluoromethoxy)-3-(1,3-oxazol-2-yl)phenyl]-2-formyl-3-iminobutanamide (PubChem CID 174262503) has the molecular formula C15H13F2N3O4 and a molecular weight of 337.28 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)-3-(1,3-oxazol-2-yl)phenyl]-2-formyl-3-iminobutanamide.
| Compound Name | N-[4-(difluoromethoxy)-3-(1,3-oxazol-2-yl)phenyl]-2-formyl-3-iminobutanamide |
|---|---|
| PubChem CID | 174262503 |
| Molecular Formula | C15H13F2N3O4 |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[4-(difluoromethoxy)-3-(1,3-oxazol-2-yl)phenyl]-2-formyl-3-iminobutanamide |
| SMILES | [H]/N=C(\C)C(C=O)C(=O)Nc1ccc(OC(F)F)c(-c2ncco2)c1 |
| InChI | InChI=1S/C15H13F2N3O4/c1-8(18)11(7-21)13(22)20-9-2-3-12(24-15(16)17)10(6-9)14-19-4-5-23-14/h2-7,11,15,18H,1H3,(H,20,22)/b18-8+ |
| InChIKey | MGMUCNMGXVGRSR-QGMBQPNBSA-N |
| XLogP | 2.74 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|