C18H26F3N3O5 — CID 174264884
tert-butyl N-[(3R)-3-[[[3-(trifluoromethoxy)cyclobutanecarbonyl]amino]carbamoyl]-1-bicyclo[2.1.1]hexanyl]carbamate (PubChem CID 174264884) has the molecular formula C18H26F3N3O5 and a molecular weight of 421.42 g/mol. Its IUPAC name is tert-butyl N-[(3R)-3-[[[3-(trifluoromethoxy)cyclobutanecarbonyl]amino]carbamoyl]-1-bicyclo[2.1.1]hexanyl]carbamate.
| Compound Name | tert-butyl N-[(3R)-3-[[[3-(trifluoromethoxy)cyclobutanecarbonyl]amino]carbamoyl]-1-bicyclo[2.1.1]hexanyl]carbamate |
|---|---|
| PubChem CID | 174264884 |
| Molecular Formula | C18H26F3N3O5 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | tert-butyl N-[(3R)-3-[[[3-(trifluoromethoxy)cyclobutanecarbonyl]amino]carbamoyl]-1-bicyclo[2.1.1]hexanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)[C@H](C(=O)NNC(=O)C1CC(OC(F)(F)F)C1)C2 |
| InChI | InChI=1S/C18H26F3N3O5/c1-16(2,3)29-15(27)22-17-6-10(7-17)12(8-17)14(26)24-23-13(25)9-4-11(5-9)28-18(19,20)21/h9-12H,4-8H2,1-3H3,(H,22,27)(H,23,25)(H,24,26)/t9?,10?,11?,12-,17?/m1/s1 |
| InChIKey | UJCTWVQSTXXWGR-XAPGEDESSA-N |
| XLogP | 2.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|