C14H21NO3S — CID 174269275
1-ethyl-3-(3-propan-2-ylsulfonylphenoxy)azetidine (PubChem CID 174269275) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 1-ethyl-3-(3-propan-2-ylsulfonylphenoxy)azetidine.
| Compound Name | 1-ethyl-3-(3-propan-2-ylsulfonylphenoxy)azetidine |
|---|---|
| PubChem CID | 174269275 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-ethyl-3-(3-propan-2-ylsulfonylphenoxy)azetidine |
| SMILES | CCN1CC(Oc2cccc(S(=O)(=O)C(C)C)c2)C1 |
| InChI | InChI=1S/C14H21NO3S/c1-4-15-9-13(10-15)18-12-6-5-7-14(8-12)19(16,17)11(2)3/h5-8,11,13H,4,9-10H2,1-3H3 |
| InChIKey | KJRJSZSDVJXLLR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |