C15H13ClNO3S+ — CID 174270872
2-[3-chloro-4-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]ethyl-oxosulfanium (PubChem CID 174270872) has the molecular formula C15H13ClNO3S+ and a molecular weight of 322.79 g/mol. Its IUPAC name is 2-[3-chloro-4-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]ethyl-oxosulfanium.
| Compound Name | 2-[3-chloro-4-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]ethyl-oxosulfanium |
|---|---|
| PubChem CID | 174270872 |
| Molecular Formula | C15H13ClNO3S+ |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-[3-chloro-4-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]ethyl-oxosulfanium |
| SMILES | O=[S+]CCc1ccc(C(=O)c2cnoc2C2CC2)c(Cl)c1 |
| InChI | InChI=1S/C15H13ClNO3S/c16-13-7-9(5-6-21-19)1-4-11(13)14(18)12-8-17-20-15(12)10-2-3-10/h1,4,7-8,10H,2-3,5-6H2/q+1 |
| InChIKey | OWNLUTUWUGREKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|