About (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone
(5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone (PubChem CID 18950244) has the molecular formula C16H15Cl2NO2S
and a molecular weight of 356.27 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone.
Molecular Properties
| Compound Name | (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone |
| PubChem CID | 18950244 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone |
| SMILES | CCSCc1c(C(=O)c2cnoc2C2CC2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15Cl2NO2S/c1-2-22-8-12-10(5-6-13(17)14(12)18)15(20)11-7-19-21-16(11)9-3-4-9/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | BEQSHYBCAWQHCY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone?
The IUPAC name of (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone (CID 18950244) is (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone.
What is the SMILES notation for (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone?
The canonical SMILES for (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone is CCSCc1c(C(=O)c2cnoc2C2CC2)ccc(Cl)c1Cl.
What is the InChIKey of (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone?
The InChIKey is BEQSHYBCAWQHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2NO2S/c1-2-22-8-12-10(5-6-13(17)14(12)18)15(20)11-7-19-21-16(11)9-3-4-9/h5-7,9H,2-4,8H2,1H3.
What are the key properties of (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone?
(5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone has a molecular weight of 356.27 g/mol, XLogP of 5.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyclopropyl-1,2-oxazol-4-yl)-[3,4-dichloro-2-(ethylsulfanylmethyl)phenyl]methanone is sourced from PubChem (CID 18950244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).