C20H22Cl2N2O4 — CID 23303124
butyl N-[2,3-dichloro-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]-N-ethylcarbamate (PubChem CID 23303124) has the molecular formula C20H22Cl2N2O4 and a molecular weight of 425.31 g/mol. Its IUPAC name is butyl N-[2,3-dichloro-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]-N-ethylcarbamate.
| Compound Name | butyl N-[2,3-dichloro-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 23303124 |
| Molecular Formula | C20H22Cl2N2O4 |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | butyl N-[2,3-dichloro-6-(5-cyclopropyl-1,2-oxazole-4-carbonyl)phenyl]-N-ethylcarbamate |
| SMILES | CCCCOC(=O)N(CC)c1c(C(=O)c2cnoc2C2CC2)ccc(Cl)c1Cl |
| InChI | InChI=1S/C20H22Cl2N2O4/c1-3-5-10-27-20(26)24(4-2)17-13(8-9-15(21)16(17)22)18(25)14-11-23-28-19(14)12-6-7-12/h8-9,11-12H,3-7,10H2,1-2H3 |
| InChIKey | GVHIREICGKQCBH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|