C13H8Cl2N2O4 — CID 54247454
(5-cyclopropyl-1,2-oxazol-4-yl)-(3,4-dichloro-2-nitrophenyl)methanone (PubChem CID 54247454) has the molecular formula C13H8Cl2N2O4 and a molecular weight of 327.12 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-4-yl)-(3,4-dichloro-2-nitrophenyl)methanone.
| Compound Name | (5-cyclopropyl-1,2-oxazol-4-yl)-(3,4-dichloro-2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 54247454 |
| Molecular Formula | C13H8Cl2N2O4 |
| Molecular Weight | 327.12 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-4-yl)-(3,4-dichloro-2-nitrophenyl)methanone |
| SMILES | O=C(c1cnoc1C1CC1)c1ccc(Cl)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8Cl2N2O4/c14-9-4-3-7(11(10(9)15)17(19)20)12(18)8-5-16-21-13(8)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | QUGSPJQISVEMMS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|