About magnesium;3,3-dimethoxydioxirane;hydride
magnesium;3,3-dimethoxydioxirane;hydride (PubChem CID 174272624) has the molecular formula C3H8MgO4
and a molecular weight of 132.40 g/mol. Its IUPAC name is magnesium;3,3-dimethoxydioxirane;hydride.
Molecular Properties
| Compound Name | magnesium;3,3-dimethoxydioxirane;hydride |
| PubChem CID | 174272624 |
| Molecular Formula | C3H8MgO4 |
| Molecular Weight | 132.40 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | magnesium;3,3-dimethoxydioxirane;hydride |
| SMILES | COC1(OC)OO1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C3H6O4.Mg.2H/c1-4-3(5-2)6-7-3;;;/h1-2H3;;;/q;+2;2*-1 |
| InChIKey | GYDRSJLPYODHJG-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.40 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze magnesium;3,3-dimethoxydioxirane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;3,3-dimethoxydioxirane;hydride?
The IUPAC name of magnesium;3,3-dimethoxydioxirane;hydride (CID 174272624) is magnesium;3,3-dimethoxydioxirane;hydride.
What is the SMILES notation for magnesium;3,3-dimethoxydioxirane;hydride?
The canonical SMILES for magnesium;3,3-dimethoxydioxirane;hydride is COC1(OC)OO1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;3,3-dimethoxydioxirane;hydride?
The InChIKey is GYDRSJLPYODHJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4.Mg.2H/c1-4-3(5-2)6-7-3;;;/h1-2H3;;;/q;+2;2*-1.
What are the key properties of magnesium;3,3-dimethoxydioxirane;hydride?
magnesium;3,3-dimethoxydioxirane;hydride has a molecular weight of 132.40 g/mol, XLogP of -0.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;3,3-dimethoxydioxirane;hydride is sourced from PubChem (CID 174272624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).