About lanthanum;3-methoxydioxiran-3-ol
lanthanum;3-methoxydioxiran-3-ol (PubChem CID 175608723) has the molecular formula C2H4LaO4
and a molecular weight of 230.96 g/mol. Its IUPAC name is lanthanum;3-methoxydioxiran-3-ol.
Molecular Properties
| Compound Name | lanthanum;3-methoxydioxiran-3-ol |
| PubChem CID | 175608723 |
| Molecular Formula | C2H4LaO4 |
| Molecular Weight | 230.96 g/mol |
| Exact Mass | 230.92 |
| IUPAC Name | lanthanum;3-methoxydioxiran-3-ol |
| SMILES | COC1(O)OO1.[La] |
| InChI | InChI=1S/C2H4O4.La/c1-4-2(3)5-6-2;/h3H,1H3; |
| InChIKey | JNWGDEZJGUSGSB-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.96 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze lanthanum;3-methoxydioxiran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lanthanum;3-methoxydioxiran-3-ol?
The IUPAC name of lanthanum;3-methoxydioxiran-3-ol (CID 175608723) is lanthanum;3-methoxydioxiran-3-ol.
What is the SMILES notation for lanthanum;3-methoxydioxiran-3-ol?
The canonical SMILES for lanthanum;3-methoxydioxiran-3-ol is COC1(O)OO1.[La].
What is the InChIKey of lanthanum;3-methoxydioxiran-3-ol?
The InChIKey is JNWGDEZJGUSGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O4.La/c1-4-2(3)5-6-2;/h3H,1H3;.
What are the key properties of lanthanum;3-methoxydioxiran-3-ol?
lanthanum;3-methoxydioxiran-3-ol has a molecular weight of 230.96 g/mol, XLogP of -0.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lanthanum;3-methoxydioxiran-3-ol is sourced from PubChem (CID 175608723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).