About 1-phenyl-7H-quinoline
1-phenyl-7H-quinoline (PubChem CID 174273205) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 1-phenyl-7H-quinoline.
Molecular Properties
| Compound Name | 1-phenyl-7H-quinoline |
| PubChem CID | 174273205 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-phenyl-7H-quinoline |
| SMILES | C1=CN(c2ccccc2)C2=CCC=CC2=C1 |
| InChI | InChI=1S/C15H13N/c1-2-9-14(10-3-1)16-12-6-8-13-7-4-5-11-15(13)16/h1-4,6-12H,5H2 |
| InChIKey | IXUPQEXRGMQRAM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenyl-7H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-7H-quinoline?
The IUPAC name of 1-phenyl-7H-quinoline (CID 174273205) is 1-phenyl-7H-quinoline.
What is the SMILES notation for 1-phenyl-7H-quinoline?
The canonical SMILES for 1-phenyl-7H-quinoline is C1=CN(c2ccccc2)C2=CCC=CC2=C1.
What is the InChIKey of 1-phenyl-7H-quinoline?
The InChIKey is IXUPQEXRGMQRAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-2-9-14(10-3-1)16-12-6-8-13-7-4-5-11-15(13)16/h1-4,6-12H,5H2.
What are the key properties of 1-phenyl-7H-quinoline?
1-phenyl-7H-quinoline has a molecular weight of 207.28 g/mol, XLogP of 3.79, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-7H-quinoline is sourced from PubChem (CID 174273205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).