C10H8F3O4S- — CID 174274247
1-[4-carboxy-3-(trifluoromethyl)phenyl]ethanesulfinate (PubChem CID 174274247) has the molecular formula C10H8F3O4S- and a molecular weight of 281.23 g/mol. Its IUPAC name is 1-[4-carboxy-3-(trifluoromethyl)phenyl]ethanesulfinate.
| Compound Name | 1-[4-carboxy-3-(trifluoromethyl)phenyl]ethanesulfinate |
|---|---|
| PubChem CID | 174274247 |
| Molecular Formula | C10H8F3O4S- |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 1-[4-carboxy-3-(trifluoromethyl)phenyl]ethanesulfinate |
| SMILES | CC(c1ccc(C(=O)O)c(C(F)(F)F)c1)S(=O)[O-] |
| InChI | InChI=1S/C10H9F3O4S/c1-5(18(16)17)6-2-3-7(9(14)15)8(4-6)10(11,12)13/h2-5H,1H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | PZINNPTZFSRUOR-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|