About methanimine;oxalic acid
methanimine;oxalic acid (PubChem CID 174274665) has the molecular formula C4H8N2O4
and a molecular weight of 148.12 g/mol. Its IUPAC name is methanimine;oxalic acid.
Molecular Properties
| Compound Name | methanimine;oxalic acid |
| PubChem CID | 174274665 |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | methanimine;oxalic acid |
| SMILES | O=C(O)C(=O)O.[H]N=C.[H]N=C |
| InChI | InChI=1S/C2H2O4.2CH3N/c3-1(4)2(5)6;2*1-2/h(H,3,4)(H,5,6);2*2H,1H2 |
| InChIKey | IAKBXBYRABBGJG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 122.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methanimine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;oxalic acid?
The IUPAC name of methanimine;oxalic acid (CID 174274665) is methanimine;oxalic acid.
What is the SMILES notation for methanimine;oxalic acid?
The canonical SMILES for methanimine;oxalic acid is O=C(O)C(=O)O.[H]N=C.[H]N=C.
What is the InChIKey of methanimine;oxalic acid?
The InChIKey is IAKBXBYRABBGJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2O4.2CH3N/c3-1(4)2(5)6;2*1-2/h(H,3,4)(H,5,6);2*2H,1H2.
What are the key properties of methanimine;oxalic acid?
methanimine;oxalic acid has a molecular weight of 148.12 g/mol, XLogP of -0.31, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;oxalic acid is sourced from PubChem (CID 174274665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).