C67H46N6O — CID 174275456
7-[7-[11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6a,11a-dihydroindolo[2,3-a]carbazol-12-yl]-9,9-dimethylfluoren-2-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 174275456) has the molecular formula C67H46N6O and a molecular weight of 951.15 g/mol. Its IUPAC name is 7-[7-[11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6a,11a-dihydroindolo[2,3-a]carbazol-12-yl]-9,9-dimethylfluoren-2-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 7-[7-[11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6a,11a-dihydroindolo[2,3-a]carbazol-12-yl]-9,9-dimethylfluoren-2-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 174275456 |
| Molecular Formula | C67H46N6O |
| Molecular Weight | 951.15 g/mol |
| Exact Mass | 950.37 |
| IUPAC Name | 7-[7-[11-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-6a,11a-dihydroindolo[2,3-a]carbazol-12-yl]-9,9-dimethylfluoren-2-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | CC1(C)c2cc(-c3cccc4nc(-c5ccccc5)oc34)ccc2-c2ccc(-n3c4c(c5ccccc53)C=CC3c5ccccc5N(c5ccc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)cc5)C43)cc21 |
| InChI | InChI=1S/C67H46N6O/c1-67(2)55-39-45(48-25-16-26-57-62(48)74-66(68-57)44-21-10-5-11-22-44)31-35-49(55)50-36-34-47(40-56(50)67)73-59-28-15-13-24-52(59)54-38-37-53-51-23-12-14-27-58(51)72(60(53)61(54)73)46-32-29-43(30-33-46)65-70-63(41-17-6-3-7-18-41)69-64(71-65)42-19-8-4-9-20-42/h3-40,53,60H,1-2H3 |
| InChIKey | RYWOMLKKRJTSNW-UHFFFAOYSA-N |
| XLogP | 16.60 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.15 |
| LogP ≤ 5 | 16.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |