C21H20ClN3OS — CID 174278382
(2Z)-3-chloro-5-methyl-2-prop-1-en-2-yl-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)hexa-2,4-dienamide (PubChem CID 174278382) has the molecular formula C21H20ClN3OS and a molecular weight of 397.93 g/mol. Its IUPAC name is (2Z)-3-chloro-5-methyl-2-prop-1-en-2-yl-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)hexa-2,4-dienamide.
| Compound Name | (2Z)-3-chloro-5-methyl-2-prop-1-en-2-yl-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 174278382 |
| Molecular Formula | C21H20ClN3OS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (2Z)-3-chloro-5-methyl-2-prop-1-en-2-yl-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)hexa-2,4-dienamide |
| SMILES | C=C(C)/C(C(=O)Nc1ccc2nc(-c3cccs3)[nH]c2c1)=C(/Cl)C=C(C)C |
| InChI | InChI=1S/C21H20ClN3OS/c1-12(2)10-15(22)19(13(3)4)21(26)23-14-7-8-16-17(11-14)25-20(24-16)18-6-5-9-27-18/h5-11H,3H2,1-2,4H3,(H,23,26)(H,24,25)/b19-15- |
| InChIKey | FQQUDCSUYYPKPV-CYVLTUHYSA-N |
| XLogP | 6.27 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|