C24H22N6O4S — CID 60562971
4-(4-acetylpiperazin-1-yl)-3-nitro-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)benzamide (PubChem CID 60562971) has the molecular formula C24H22N6O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)benzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)benzamide |
|---|---|
| PubChem CID | 60562971 |
| Molecular Formula | C24H22N6O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-3-nitro-N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)benzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)Nc3ccc4nc(-c5cccs5)[nH]c4c3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H22N6O4S/c1-15(31)28-8-10-29(11-9-28)20-7-4-16(13-21(20)30(33)34)24(32)25-17-5-6-18-19(14-17)27-23(26-18)22-3-2-12-35-22/h2-7,12-14H,8-11H2,1H3,(H,25,32)(H,26,27) |
| InChIKey | RDHITLZPJDRRLV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|