C27H26ClN5O3 — CID 54858257
N-[3-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 54858257) has the molecular formula C27H26ClN5O3 and a molecular weight of 503.99 g/mol. Its IUPAC name is N-[3-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[3-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 54858257 |
| Molecular Formula | C27H26ClN5O3 |
| Molecular Weight | 503.99 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[3-(5-chloro-6-methyl-1H-benzimidazol-2-yl)phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | Cc1cc2[nH]c(-c3cccc(NC(=O)c4ccc(N5CCC(C)CC5)c([N+](=O)[O-])c4)c3)nc2cc1Cl |
| InChI | InChI=1S/C27H26ClN5O3/c1-16-8-10-32(11-9-16)24-7-6-19(14-25(24)33(35)36)27(34)29-20-5-3-4-18(13-20)26-30-22-12-17(2)21(28)15-23(22)31-26/h3-7,12-16H,8-11H2,1-2H3,(H,29,34)(H,30,31) |
| InChIKey | ZURJAKPHYWGHMA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.99 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|