C22H22N6O4 — CID 108747774
4-(4-methylpiperazin-1-yl)-3-nitro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide (PubChem CID 108747774) has the molecular formula C22H22N6O4 and a molecular weight of 434.46 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-3-nitro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-3-nitro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 108747774 |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-3-nitro-N-[3-(6-oxo-1H-pyridazin-3-yl)phenyl]benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)Nc3cccc(-c4ccc(=O)[nH]n4)c3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H22N6O4/c1-26-9-11-27(12-10-26)19-7-5-16(14-20(19)28(31)32)22(30)23-17-4-2-3-15(13-17)18-6-8-21(29)25-24-18/h2-8,13-14H,9-12H2,1H3,(H,23,30)(H,25,29) |
| InChIKey | QRUKZQFCHZNUFI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 124.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|