C31H26ClN3 — CID 174278425
2-[4-[4-(3-chlorobutyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 174278425) has the molecular formula C31H26ClN3 and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-[4-[4-(3-chlorobutyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[4-(3-chlorobutyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174278425 |
| Molecular Formula | C31H26ClN3 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[4-[4-(3-chlorobutyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC(Cl)CCc1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C31H26ClN3/c1-22(32)12-13-23-14-16-24(17-15-23)25-18-20-28(21-19-25)31-34-29(26-8-4-2-5-9-26)33-30(35-31)27-10-6-3-7-11-27/h2-11,14-22H,12-13H2,1H3 |
| InChIKey | JJNHQJWJKPRONZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|