C30H35N7O2 — CID 174278661
tert-butyl 4-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]piperazine-1-carboxylate (PubChem CID 174278661) has the molecular formula C30H35N7O2 and a molecular weight of 525.66 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174278661 |
| Molecular Formula | C30H35N7O2 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | tert-butyl 4-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]piperazine-1-carboxylate |
| SMILES | C=CCC(N1CCN(C(=O)OC(C)(C)C)CC1)n1c(-c2cccnc2N)nc2ccc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C30H35N7O2/c1-5-10-25(35-17-19-36(20-18-35)29(38)39-30(2,3)4)37-27(22-13-9-16-32-26(22)31)34-24-15-14-23(33-28(24)37)21-11-7-6-8-12-21/h5-9,11-16,25H,1,10,17-20H2,2-4H3,(H2,31,32) |
| InChIKey | RRXXABQIZOINON-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|