C32H39N7O2 — CID 171068728
tert-butyl N-[1-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]azepan-4-yl]carbamate (PubChem CID 171068728) has the molecular formula C32H39N7O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is tert-butyl N-[1-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]azepan-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]azepan-4-yl]carbamate |
|---|---|
| PubChem CID | 171068728 |
| Molecular Formula | C32H39N7O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | tert-butyl N-[1-[1-[2-(2-amino-3-pyridinyl)-5-phenylimidazo[4,5-b]pyridin-3-yl]but-3-enyl]azepan-4-yl]carbamate |
| SMILES | C=CCC(N1CCCC(NC(=O)OC(C)(C)C)CC1)n1c(-c2cccnc2N)nc2ccc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C32H39N7O2/c1-5-11-27(38-20-10-14-23(18-21-38)35-31(40)41-32(2,3)4)39-29(24-15-9-19-34-28(24)33)37-26-17-16-25(36-30(26)39)22-12-7-6-8-13-22/h5-9,12-13,15-17,19,23,27H,1,10-11,14,18,20-21H2,2-4H3,(H2,33,34)(H,35,40) |
| InChIKey | OKSJCBIHXWAPCC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|