C26H26N8 — CID 174276191
3-[2-(2-amino-3-pyridinyl)-3-(1-piperazin-1-ylbut-3-enyl)imidazo[4,5-b]pyridin-5-yl]benzonitrile (PubChem CID 174276191) has the molecular formula C26H26N8 and a molecular weight of 450.55 g/mol. Its IUPAC name is 3-[2-(2-amino-3-pyridinyl)-3-(1-piperazin-1-ylbut-3-enyl)imidazo[4,5-b]pyridin-5-yl]benzonitrile.
| Compound Name | 3-[2-(2-amino-3-pyridinyl)-3-(1-piperazin-1-ylbut-3-enyl)imidazo[4,5-b]pyridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 174276191 |
| Molecular Formula | C26H26N8 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 3-[2-(2-amino-3-pyridinyl)-3-(1-piperazin-1-ylbut-3-enyl)imidazo[4,5-b]pyridin-5-yl]benzonitrile |
| SMILES | C=CCC(N1CCNCC1)n1c(-c2cccnc2N)nc2ccc(-c3cccc(C#N)c3)nc21 |
| InChI | InChI=1S/C26H26N8/c1-2-5-23(33-14-12-29-13-15-33)34-25(20-8-4-11-30-24(20)28)32-22-10-9-21(31-26(22)34)19-7-3-6-18(16-19)17-27/h2-4,6-11,16,23,29H,1,5,12-15H2,(H2,28,30) |
| InChIKey | BSYHIQUQPXCHAD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|