C14H17NO5 — CID 174279666
(2R)-4-acetyloxy-2-(benzylamino)-3-methyl-4-oxobutanoic acid (PubChem CID 174279666) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is (2R)-4-acetyloxy-2-(benzylamino)-3-methyl-4-oxobutanoic acid.
| Compound Name | (2R)-4-acetyloxy-2-(benzylamino)-3-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174279666 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2R)-4-acetyloxy-2-(benzylamino)-3-methyl-4-oxobutanoic acid |
| SMILES | CC(=O)OC(=O)C(C)[C@@H](NCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H17NO5/c1-9(14(19)20-10(2)16)12(13(17)18)15-8-11-6-4-3-5-7-11/h3-7,9,12,15H,8H2,1-2H3,(H,17,18)/t9?,12-/m1/s1 |
| InChIKey | AVXBSZRPUMOKFM-FFFFSGIJSA-N |
| XLogP | 0.96 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|