C15H15NS — CID 174281222
1-(2-thiophen-2-ylethyl)-4H-quinoline (PubChem CID 174281222) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-(2-thiophen-2-ylethyl)-4H-quinoline.
| Compound Name | 1-(2-thiophen-2-ylethyl)-4H-quinoline |
|---|---|
| PubChem CID | 174281222 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(2-thiophen-2-ylethyl)-4H-quinoline |
| SMILES | C1=CN(CCc2cccs2)c2ccccc2C1 |
| InChI | InChI=1S/C15H15NS/c1-2-8-15-13(5-1)6-3-10-16(15)11-9-14-7-4-12-17-14/h1-5,7-8,10,12H,6,9,11H2 |
| InChIKey | BCTAMZSGJRNDAX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |