C17H24N2O4S — CID 174282450
2-[(2-amino-3-methylbutanoyl)-benzoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 174282450) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[(2-amino-3-methylbutanoyl)-benzoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(2-amino-3-methylbutanoyl)-benzoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 174282450 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[(2-amino-3-methylbutanoyl)-benzoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N(C(=O)c1ccccc1)C(=O)C(N)C(C)C |
| InChI | InChI=1S/C17H24N2O4S/c1-11(2)14(18)16(21)19(13(17(22)23)9-10-24-3)15(20)12-7-5-4-6-8-12/h4-8,11,13-14H,9-10,18H2,1-3H3,(H,22,23) |
| InChIKey | OETXXNLBBLOTLJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |