C21H31N3O5S — CID 87060420
2-[(2-amino-4-methylpentanoyl)-(2-amino-4-methylsulfanylbutanoyl)amino]-3-(2-formylphenyl)propanoic acid (PubChem CID 87060420) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is 2-[(2-amino-4-methylpentanoyl)-(2-amino-4-methylsulfanylbutanoyl)amino]-3-(2-formylphenyl)propanoic acid.
| Compound Name | 2-[(2-amino-4-methylpentanoyl)-(2-amino-4-methylsulfanylbutanoyl)amino]-3-(2-formylphenyl)propanoic acid |
|---|---|
| PubChem CID | 87060420 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[(2-amino-4-methylpentanoyl)-(2-amino-4-methylsulfanylbutanoyl)amino]-3-(2-formylphenyl)propanoic acid |
| SMILES | CSCCC(N)C(=O)N(C(=O)C(N)CC(C)C)C(Cc1ccccc1C=O)C(=O)O |
| InChI | InChI=1S/C21H31N3O5S/c1-13(2)10-17(23)20(27)24(19(26)16(22)8-9-30-3)18(21(28)29)11-14-6-4-5-7-15(14)12-25/h4-7,12-13,16-18H,8-11,22-23H2,1-3H3,(H,28,29) |
| InChIKey | RFLWWSOAHFDEQF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|