C29H29NO2P2S — CID 126648246
(2S)-2-[bis(diphenylphosphanyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 126648246) has the molecular formula C29H29NO2P2S and a molecular weight of 517.57 g/mol. Its IUPAC name is (2S)-2-[bis(diphenylphosphanyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[bis(diphenylphosphanyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 126648246 |
| Molecular Formula | C29H29NO2P2S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (2S)-2-[bis(diphenylphosphanyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29NO2P2S/c1-35-23-22-28(29(31)32)30(33(24-14-6-2-7-15-24)25-16-8-3-9-17-25)34(26-18-10-4-11-19-26)27-20-12-5-13-21-27/h2-21,28H,22-23H2,1H3,(H,31,32)/t28-/m0/s1 |
| InChIKey | QMMOAZMBFAZKBM-NDEPHWFRSA-N |
| XLogP | 5.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|