C18H22NPS — CID 89048344
(3S)-2-diphenylphosphanyl-5-methylsulfanylpent-1-en-3-amine (PubChem CID 89048344) has the molecular formula C18H22NPS and a molecular weight of 315.42 g/mol. Its IUPAC name is (3S)-2-diphenylphosphanyl-5-methylsulfanylpent-1-en-3-amine.
| Compound Name | (3S)-2-diphenylphosphanyl-5-methylsulfanylpent-1-en-3-amine |
|---|---|
| PubChem CID | 89048344 |
| Molecular Formula | C18H22NPS |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (3S)-2-diphenylphosphanyl-5-methylsulfanylpent-1-en-3-amine |
| SMILES | C=C([C@@H](N)CCSC)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22NPS/c1-15(18(19)13-14-21-2)20(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,18H,1,13-14,19H2,2H3/t18-/m0/s1 |
| InChIKey | INPGLBZRXLONNF-SFHVURJKSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|