C11H27NO2SSi2 — CID 172597175
(2S)-2-[bis(trimethylsilyl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 172597175) has the molecular formula C11H27NO2SSi2 and a molecular weight of 293.58 g/mol. Its IUPAC name is (2S)-2-[bis(trimethylsilyl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[bis(trimethylsilyl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 172597175 |
| Molecular Formula | C11H27NO2SSi2 |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | (2S)-2-[bis(trimethylsilyl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C11H27NO2SSi2/c1-15-9-8-10(11(13)14)12(16(2,3)4)17(5,6)7/h10H,8-9H2,1-7H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | OJRPSMZPACFFSF-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|