C7H13NO6S2 — CID 174703723
2-[acetyl(sulfo)amino]-4-methylsulfanylbutanoic acid (PubChem CID 174703723) has the molecular formula C7H13NO6S2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[acetyl(sulfo)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[acetyl(sulfo)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 174703723 |
| Molecular Formula | C7H13NO6S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-[acetyl(sulfo)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N(C(C)=O)S(=O)(=O)O |
| InChI | InChI=1S/C7H13NO6S2/c1-5(9)8(16(12,13)14)6(7(10)11)3-4-15-2/h6H,3-4H2,1-2H3,(H,10,11)(H,12,13,14) |
| InChIKey | RWJJEVVJQCYVGF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|