C10H21NO2S — CID 145086397
2-[ethyl(propan-2-yl)amino]-4-methylsulfanylbutanoic acid (PubChem CID 145086397) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-[ethyl(propan-2-yl)amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[ethyl(propan-2-yl)amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 145086397 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-[ethyl(propan-2-yl)amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCN(C(C)C)C(CCSC)C(=O)O |
| InChI | InChI=1S/C10H21NO2S/c1-5-11(8(2)3)9(10(12)13)6-7-14-4/h8-9H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | DZCFBLSPMUYSCA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |