C9H16N2O5S — CID 175795765
(2S)-2-[[[(1S)-1-carboxyethyl]amino]-formylamino]-4-methylsulfanylbutanoic acid (PubChem CID 175795765) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is (2S)-2-[[[(1S)-1-carboxyethyl]amino]-formylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[[(1S)-1-carboxyethyl]amino]-formylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 175795765 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (2S)-2-[[[(1S)-1-carboxyethyl]amino]-formylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](C(=O)O)N(C=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-6(8(13)14)10-11(5-12)7(9(15)16)3-4-17-2/h5-7,10H,3-4H2,1-2H3,(H,13,14)(H,15,16)/t6-,7-/m0/s1 |
| InChIKey | PIHNZQKGZBNTOR-BQBZGAKWSA-N |
| XLogP | -0.37 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|