C10H13ClN4O2S — CID 174283154
2-chloro-5-(cyclopropylmethyl)pyridine;N'-nitrocarbamimidothioic acid (PubChem CID 174283154) has the molecular formula C10H13ClN4O2S and a molecular weight of 288.76 g/mol. Its IUPAC name is 2-chloro-5-(cyclopropylmethyl)pyridine;N'-nitrocarbamimidothioic acid.
| Compound Name | 2-chloro-5-(cyclopropylmethyl)pyridine;N'-nitrocarbamimidothioic acid |
|---|---|
| PubChem CID | 174283154 |
| Molecular Formula | C10H13ClN4O2S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-chloro-5-(cyclopropylmethyl)pyridine;N'-nitrocarbamimidothioic acid |
| SMILES | Clc1ccc(CC2CC2)cn1.NC(S)=N[N+](=O)[O-] |
| InChI | InChI=1S/C9H10ClN.CH3N3O2S/c10-9-4-3-8(6-11-9)5-7-1-2-7;2-1(7)3-4(5)6/h3-4,6-7H,1-2,5H2;(H3,2,3,7) |
| InChIKey | KJRLQSYHYBCCKD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|