C21H28BFN4O2 — CID 174283512
CID 174283512 (PubChem CID 174283512) has the molecular formula C21H28BFN4O2 and a molecular weight of 398.29 g/mol.
| Compound Name | CID 174283512 |
|---|---|
| PubChem CID | 174283512 |
| Molecular Formula | C21H28BFN4O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)C(NC(=O)C(C)C/C=N/C)C(C2CCC2)C2CC2)nc1F |
| InChI | InChI=1S/C21H28BFN4O2/c1-12(10-11-24-2)20(28)27-18(17(14-6-7-14)13-4-3-5-13)21(29)26-16-9-8-15(22)19(23)25-16/h8-9,11-14,17-18H,3-7,10H2,1-2H3,(H,27,28)(H,25,26,29)/b24-11+ |
| InChIKey | HSJGVLLYKKHEBD-BHGWPJFGSA-N |
| XLogP | 1.99 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|