C10H16N4O — CID 174285577
1-(1-piperidin-4-yl-1,2,4-triazol-3-yl)cyclopropan-1-ol (PubChem CID 174285577) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(1-piperidin-4-yl-1,2,4-triazol-3-yl)cyclopropan-1-ol.
| Compound Name | 1-(1-piperidin-4-yl-1,2,4-triazol-3-yl)cyclopropan-1-ol |
|---|---|
| PubChem CID | 174285577 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-(1-piperidin-4-yl-1,2,4-triazol-3-yl)cyclopropan-1-ol |
| SMILES | OC1(c2ncn(C3CCNCC3)n2)CC1 |
| InChI | InChI=1S/C10H16N4O/c15-10(3-4-10)9-12-7-14(13-9)8-1-5-11-6-2-8/h7-8,11,15H,1-6H2 |
| InChIKey | NVWKPWIPQHLOCR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |