C8H16N2O4 — CID 174287516
2,3-dihydroxypropyl piperazine-1-carboxylate (PubChem CID 174287516) has the molecular formula C8H16N2O4 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2,3-dihydroxypropyl piperazine-1-carboxylate.
| Compound Name | 2,3-dihydroxypropyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174287516 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2,3-dihydroxypropyl piperazine-1-carboxylate |
| SMILES | O=C(OCC(O)CO)N1CCNCC1 |
| InChI | InChI=1S/C8H16N2O4/c11-5-7(12)6-14-8(13)10-3-1-9-2-4-10/h7,9,11-12H,1-6H2 |
| InChIKey | OOVMNSPDCUYBOM-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |