C7H16N2O3 — CID 175819854
3-piperazin-1-yloxypropane-1,2-diol (PubChem CID 175819854) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3-piperazin-1-yloxypropane-1,2-diol.
| Compound Name | 3-piperazin-1-yloxypropane-1,2-diol |
|---|---|
| PubChem CID | 175819854 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3-piperazin-1-yloxypropane-1,2-diol |
| SMILES | OCC(O)CON1CCNCC1 |
| InChI | InChI=1S/C7H16N2O3/c10-5-7(11)6-12-9-3-1-8-2-4-9/h7-8,10-11H,1-6H2 |
| InChIKey | CYQVFMCCFKJYKI-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |