C26H28Cl2N2O7 — CID 174289176
2-[[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-[2-(2-methoxyethoxy)ethoxy]propanoyl]amino]benzoic acid (PubChem CID 174289176) has the molecular formula C26H28Cl2N2O7 and a molecular weight of 551.42 g/mol. Its IUPAC name is 2-[[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-[2-(2-methoxyethoxy)ethoxy]propanoyl]amino]benzoic acid.
| Compound Name | 2-[[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-[2-(2-methoxyethoxy)ethoxy]propanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 174289176 |
| Molecular Formula | C26H28Cl2N2O7 |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 2-[[2-[[5-(2,5-dichlorophenyl)furan-2-yl]methylamino]-3-[2-(2-methoxyethoxy)ethoxy]propanoyl]amino]benzoic acid |
| SMILES | COCCOCCOCC(NCc1ccc(-c2cc(Cl)ccc2Cl)o1)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H28Cl2N2O7/c1-34-10-11-35-12-13-36-16-23(25(31)30-22-5-3-2-4-19(22)26(32)33)29-15-18-7-9-24(37-18)20-14-17(27)6-8-21(20)28/h2-9,14,23,29H,10-13,15-16H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | AZKBPRJOUFGEFS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 119.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|