C24H27FN4O3 — CID 174289231
N-cyclopropyl-N-[5-(2-cyclopropylethynyl)-2-fluorophenyl]-3-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-2-hydrazinylidenepropanamide (PubChem CID 174289231) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is N-cyclopropyl-N-[5-(2-cyclopropylethynyl)-2-fluorophenyl]-3-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-2-hydrazinylidenepropanamide.
| Compound Name | N-cyclopropyl-N-[5-(2-cyclopropylethynyl)-2-fluorophenyl]-3-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-2-hydrazinylidenepropanamide |
|---|---|
| PubChem CID | 174289231 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | N-cyclopropyl-N-[5-(2-cyclopropylethynyl)-2-fluorophenyl]-3-(5,7-dioxaspiro[2.5]octan-6-ylmethylimino)-2-hydrazinylidenepropanamide |
| SMILES | NN=C(/C=N/CC1OCC2(CC2)CO1)C(=O)N(c1cc(C#CC2CC2)ccc1F)C1CC1 |
| InChI | InChI=1S/C24H27FN4O3/c25-19-8-5-17(4-3-16-1-2-16)11-21(19)29(18-6-7-18)23(30)20(28-26)12-27-13-22-31-14-24(9-10-24)15-32-22/h5,8,11-12,16,18,22H,1-2,6-7,9-10,13-15,26H2/b27-12+,28-20? |
| InChIKey | SJSGEEUYDNMWIC-FOZYQKFJSA-N |
| XLogP | 2.62 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|