C50H49N3 — CID 174290455
9,9-dimethyl-N-[4-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)cyclohexa-1,5-dien-1-yl]-N-(4-pyridin-3-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydrofluoren-2-amine (PubChem CID 174290455) has the molecular formula C50H49N3 and a molecular weight of 691.96 g/mol. Its IUPAC name is 9,9-dimethyl-N-[4-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)cyclohexa-1,5-dien-1-yl]-N-(4-pyridin-3-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydrofluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-[4-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)cyclohexa-1,5-dien-1-yl]-N-(4-pyridin-3-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydrofluoren-2-amine |
|---|---|
| PubChem CID | 174290455 |
| Molecular Formula | C50H49N3 |
| Molecular Weight | 691.96 g/mol |
| Exact Mass | 691.39 |
| IUPAC Name | 9,9-dimethyl-N-[4-(9-phenyl-1,2,7,8-tetrahydrocarbazol-3-yl)cyclohexa-1,5-dien-1-yl]-N-(4-pyridin-3-ylcyclohexa-1,3-dien-1-yl)-2,3,5,6-tetrahydrofluoren-2-amine |
| SMILES | CC1(C)C2=CC(N(C3=CCC(C4=Cc5c6c(n(-c7ccccc7)c5CC4)CCC=C6)C=C3)C3=CC=C(c4cccnc4)CC3)CC=C2C2=C1C=CCC2 |
| InChI | InChI=1S/C50H49N3/c1-50(2)46-16-8-6-14-42(46)43-28-27-41(32-47(43)50)52(40-25-20-35(21-26-40)37-11-10-30-51-33-37)39-23-18-34(19-24-39)36-22-29-49-45(31-36)44-15-7-9-17-48(44)53(49)38-12-4-3-5-13-38/h3-5,7-8,10-13,15-16,18,20,23-25,28,30-34,41H,6,9,14,17,19,21-22,26-27,29H2,1-2H3 |
| InChIKey | BDIJWHJJCOMIDT-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.96 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |