C50H38Cl3N3O6 — CID 174291020
1H-1,4-benzodiazepine;4-methylbenzene-1,3-dicarboxylic acid;2,3,5-trichloro-N-[4-(2,3,4,5-tetrahydrochrysene-1-carbonyl)phenyl]benzamide (PubChem CID 174291020) has the molecular formula C50H38Cl3N3O6 and a molecular weight of 883.23 g/mol. Its IUPAC name is 1H-1,4-benzodiazepine;4-methylbenzene-1,3-dicarboxylic acid;2,3,5-trichloro-N-[4-(2,3,4,5-tetrahydrochrysene-1-carbonyl)phenyl]benzamide.
| Compound Name | 1H-1,4-benzodiazepine;4-methylbenzene-1,3-dicarboxylic acid;2,3,5-trichloro-N-[4-(2,3,4,5-tetrahydrochrysene-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 174291020 |
| Molecular Formula | C50H38Cl3N3O6 |
| Molecular Weight | 883.23 g/mol |
| Exact Mass | 881.18 |
| IUPAC Name | 1H-1,4-benzodiazepine;4-methylbenzene-1,3-dicarboxylic acid;2,3,5-trichloro-N-[4-(2,3,4,5-tetrahydrochrysene-1-carbonyl)phenyl]benzamide |
| SMILES | C1=CNc2ccccc2C=N1.Cc1ccc(C(=O)O)cc1C(=O)O.O=C(C1=c2ccc3c(c2CCC1)CC=c1ccccc1=3)c1ccc(NC(=O)c2cc(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C32H22Cl3NO2.C9H8N2.C9H8O4/c33-20-16-28(30(35)29(34)17-20)32(38)36-21-11-8-19(9-12-21)31(37)27-7-3-6-23-25-13-10-18-4-1-2-5-22(18)24(25)14-15-26(23)27;1-2-4-9-8(3-1)7-10-5-6-11-9;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h1-2,4-5,8-12,14-17H,3,6-7,13H2,(H,36,38);1-7,11H;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | NLIXXONLXZKCIK-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.23 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|