C43H76N4O6 — CID 174291886
dec-3-ynyl 6-[3-[3-[[3-[(6-dec-3-ynoxy-6-oxohexyl)amino]-3-oxopropyl]-methylamino]propyl-methylamino]propanoylamino]hexanoate (PubChem CID 174291886) has the molecular formula C43H76N4O6 and a molecular weight of 745.10 g/mol. Its IUPAC name is dec-3-ynyl 6-[3-[3-[[3-[(6-dec-3-ynoxy-6-oxohexyl)amino]-3-oxopropyl]-methylamino]propyl-methylamino]propanoylamino]hexanoate.
| Compound Name | dec-3-ynyl 6-[3-[3-[[3-[(6-dec-3-ynoxy-6-oxohexyl)amino]-3-oxopropyl]-methylamino]propyl-methylamino]propanoylamino]hexanoate |
|---|---|
| PubChem CID | 174291886 |
| Molecular Formula | C43H76N4O6 |
| Molecular Weight | 745.10 g/mol |
| Exact Mass | 744.58 |
| IUPAC Name | dec-3-ynyl 6-[3-[3-[[3-[(6-dec-3-ynoxy-6-oxohexyl)amino]-3-oxopropyl]-methylamino]propyl-methylamino]propanoylamino]hexanoate |
| SMILES | CCCCCCC#CCCOC(=O)CCCCCNC(=O)CCN(C)CCCN(C)CCC(=O)NCCCCCC(=O)OCCC#CCCCCCC |
| InChI | InChI=1S/C43H76N4O6/c1-5-7-9-11-13-15-17-25-38-52-42(50)28-21-19-23-32-44-40(48)30-36-46(3)34-27-35-47(4)37-31-41(49)45-33-24-20-22-29-43(51)53-39-26-18-16-14-12-10-8-6-2/h5-14,19-39H2,1-4H3,(H,44,48)(H,45,49) |
| InChIKey | PZOQPDQMJPXOAE-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.10 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|