C16H18N4O5S — CID 174295189
3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfinoamino)phenyl]propanoic acid (PubChem CID 174295189) has the molecular formula C16H18N4O5S and a molecular weight of 378.41 g/mol. Its IUPAC name is 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfinoamino)phenyl]propanoic acid.
| Compound Name | 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfinoamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 174295189 |
| Molecular Formula | C16H18N4O5S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfinoamino)phenyl]propanoic acid |
| SMILES | Nc1ccc(NC(=O)NC(CC(=O)O)c2cccc(NS(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H18N4O5S/c17-11-4-6-12(7-5-11)18-16(23)19-14(9-15(21)22)10-2-1-3-13(8-10)20-26(24)25/h1-8,14,20H,9,17H2,(H,21,22)(H,24,25)(H2,18,19,23) |
| InChIKey | HFMAQEDQHFTHPH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|