C26H30N6O6S — CID 87755117
3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfonylamino)phenyl]propanoic acid;1-phenyl-3-propylurea (PubChem CID 87755117) has the molecular formula C26H30N6O6S and a molecular weight of 554.63 g/mol. Its IUPAC name is 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfonylamino)phenyl]propanoic acid;1-phenyl-3-propylurea.
| Compound Name | 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfonylamino)phenyl]propanoic acid;1-phenyl-3-propylurea |
|---|---|
| PubChem CID | 87755117 |
| Molecular Formula | C26H30N6O6S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | 3-[(4-aminophenyl)carbamoylamino]-3-[3-(sulfonylamino)phenyl]propanoic acid;1-phenyl-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccccc1.Nc1ccc(NC(=O)NC(CC(=O)O)c2cccc(N=S(=O)=O)c2)cc1 |
| InChI | InChI=1S/C16H16N4O5S.C10H14N2O/c17-11-4-6-12(7-5-11)18-16(23)19-14(9-15(21)22)10-2-1-3-13(8-10)20-26(24)25;1-2-8-11-10(13)12-9-6-4-3-5-7-9/h1-8,14H,9,17H2,(H,21,22)(H2,18,19,23);3-7H,2,8H2,1H3,(H2,11,12,13) |
| InChIKey | POABQAHRLNLEDF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 192.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|