About sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate
sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate (PubChem CID 174295959) has the molecular formula C21H44NNaO4S
and a molecular weight of 429.64 g/mol. Its IUPAC name is sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate |
| PubChem CID | 174295959 |
| Molecular Formula | C21H44NNaO4S |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCOS(=O)(=O)CCN.[H-].[Na+] |
| InChI | InChI=1S/C21H43NO4S.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-25-21-26-27(23,24)20-18-22;;/h9-10H,2-8,11-22H2,1H3;;/q;+1;-1/b10-9-;; |
| InChIKey | FGZOHJGNWJUATG-XXAVUKJNSA-N |
| XLogP | 2.42 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate?
The IUPAC name of sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate (CID 174295959) is sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate.
What is the SMILES notation for sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate?
The canonical SMILES for sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate is CCCCCCCC/C=C\CCCCCCCCOCOS(=O)(=O)CCN.[H-].[Na+].
What is the InChIKey of sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate?
The InChIKey is FGZOHJGNWJUATG-XXAVUKJNSA-N. The full InChI is InChI=1S/C21H43NO4S.Na.H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-25-21-26-27(23,24)20-18-22;;/h9-10H,2-8,11-22H2,1H3;;/q;+1;-1/b10-9-;;.
What are the key properties of sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate?
sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate has a molecular weight of 429.64 g/mol, XLogP of 2.42, 21 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;[(Z)-octadec-9-enoxy]methyl 2-aminoethanesulfonate is sourced from PubChem (CID 174295959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).