C21H24N4O4S — CID 174296955
2-[4-[formyl(methyl)amino]phenyl]-4,5-dimethyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 174296955) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-[4-[formyl(methyl)amino]phenyl]-4,5-dimethyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 2-[4-[formyl(methyl)amino]phenyl]-4,5-dimethyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 174296955 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[4-[formyl(methyl)amino]phenyl]-4,5-dimethyl-3-(4-methylsulfonylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | CC1=C(c2ccc(S(C)(=O)=O)cc2)N(c2ccc(N(C)C=O)cc2)NC1(C)C(N)=O |
| InChI | InChI=1S/C21H24N4O4S/c1-14-19(15-5-11-18(12-6-15)30(4,28)29)25(23-21(14,2)20(22)27)17-9-7-16(8-10-17)24(3)13-26/h5-13,23H,1-4H3,(H2,22,27) |
| InChIKey | JQBJEEAGPRVPHX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|